C21H36O2 — CID 22749796
2-(7-ethoxy-3,7-dimethyloctoxy)-1-ethyl-3-methylbenzene (PubChem CID 22749796) has the molecular formula C21H36O2 and a molecular weight of 320.52 g/mol. Its IUPAC name is 2-(7-ethoxy-3,7-dimethyloctoxy)-1-ethyl-3-methylbenzene.
| Compound Name | 2-(7-ethoxy-3,7-dimethyloctoxy)-1-ethyl-3-methylbenzene |
|---|---|
| PubChem CID | 22749796 |
| Molecular Formula | C21H36O2 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.27 |
| IUPAC Name | 2-(7-ethoxy-3,7-dimethyloctoxy)-1-ethyl-3-methylbenzene |
| SMILES | CCOC(C)(C)CCCC(C)CCOc1c(C)cccc1CC |
| InChI | InChI=1S/C21H36O2/c1-7-19-13-9-12-18(4)20(19)22-16-14-17(3)11-10-15-21(5,6)23-8-2/h9,12-13,17H,7-8,10-11,14-16H2,1-6H3 |
| InChIKey | VMJOZSIPAVSGAE-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |