C18H30O2 — CID 91472485
1-ethyl-2,3-bis(3-methylbutoxy)benzene (PubChem CID 91472485) has the molecular formula C18H30O2 and a molecular weight of 278.44 g/mol. Its IUPAC name is 1-ethyl-2,3-bis(3-methylbutoxy)benzene.
| Compound Name | 1-ethyl-2,3-bis(3-methylbutoxy)benzene |
|---|---|
| PubChem CID | 91472485 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | 1-ethyl-2,3-bis(3-methylbutoxy)benzene |
| SMILES | CCc1cccc(OCCC(C)C)c1OCCC(C)C |
| InChI | InChI=1S/C18H30O2/c1-6-16-8-7-9-17(19-12-10-14(2)3)18(16)20-13-11-15(4)5/h7-9,14-15H,6,10-13H2,1-5H3 |
| InChIKey | JNATZERJUKMHFJ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |