C13H17NO — CID 141124794
4-(3-methylbutoxy)-1H-indole (PubChem CID 141124794) has the molecular formula C13H17NO and a molecular weight of 203.29 g/mol. Its IUPAC name is 4-(3-methylbutoxy)-1H-indole.
| Compound Name | 4-(3-methylbutoxy)-1H-indole |
|---|---|
| PubChem CID | 141124794 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 4-(3-methylbutoxy)-1H-indole |
| SMILES | CC(C)CCOc1cccc2[nH]ccc12 |
| InChI | InChI=1S/C13H17NO/c1-10(2)7-9-15-13-5-3-4-12-11(13)6-8-14-12/h3-6,8,10,14H,7,9H2,1-2H3 |
| InChIKey | UWDDQXLABFHOLJ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |