C24H34FN5O2 — CID 123230205
3-[3-[3-[2-[3-(cyclopropylmethoxy)-4-fluorophenyl]butyl]triazol-4-yl]propylamino]piperidin-2-one (PubChem CID 123230205) has the molecular formula C24H34FN5O2 and a molecular weight of 443.57 g/mol. Its IUPAC name is 3-[3-[3-[2-[3-(cyclopropylmethoxy)-4-fluorophenyl]butyl]triazol-4-yl]propylamino]piperidin-2-one.
| Compound Name | 3-[3-[3-[2-[3-(cyclopropylmethoxy)-4-fluorophenyl]butyl]triazol-4-yl]propylamino]piperidin-2-one |
|---|---|
| PubChem CID | 123230205 |
| Molecular Formula | C24H34FN5O2 |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.27 |
| IUPAC Name | 3-[3-[3-[2-[3-(cyclopropylmethoxy)-4-fluorophenyl]butyl]triazol-4-yl]propylamino]piperidin-2-one |
| SMILES | CCC(Cn1nncc1CCCNC1CCCNC1=O)c1ccc(F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C24H34FN5O2/c1-2-18(19-9-10-21(25)23(13-19)32-16-17-7-8-17)15-30-20(14-28-29-30)5-3-11-26-22-6-4-12-27-24(22)31/h9-10,13-14,17-18,22,26H,2-8,11-12,15-16H2,1H3,(H,27,31) |
| InChIKey | PGKOYHHVZYXFQL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|