C20H25N3O3 — CID 135220387
1-[5-[[(1R)-1-(2-ethynylphenyl)ethyl]amino]pentoxymethyl]pyrimidine-2,4-dione (PubChem CID 135220387) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is 1-[5-[[(1R)-1-(2-ethynylphenyl)ethyl]amino]pentoxymethyl]pyrimidine-2,4-dione.
| Compound Name | 1-[5-[[(1R)-1-(2-ethynylphenyl)ethyl]amino]pentoxymethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 135220387 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 1-[5-[[(1R)-1-(2-ethynylphenyl)ethyl]amino]pentoxymethyl]pyrimidine-2,4-dione |
| SMILES | C#Cc1ccccc1[C@@H](C)NCCCCCOCn1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C20H25N3O3/c1-3-17-9-5-6-10-18(17)16(2)21-12-7-4-8-14-26-15-23-13-11-19(24)22-20(23)25/h1,5-6,9-11,13,16,21H,4,7-8,12,14-15H2,2H3,(H,22,24,25)/t16-/m1/s1 |
| InChIKey | FSGIDGVLILCZJG-MRXNPFEDSA-N |
| XLogP | 2.01 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|