C22H39NO — CID 54807415
N-[1-(2-hexoxyphenyl)ethyl]octan-1-amine (PubChem CID 54807415) has the molecular formula C22H39NO and a molecular weight of 333.56 g/mol. Its IUPAC name is N-[1-(2-hexoxyphenyl)ethyl]octan-1-amine.
| Compound Name | N-[1-(2-hexoxyphenyl)ethyl]octan-1-amine |
|---|---|
| PubChem CID | 54807415 |
| Molecular Formula | C22H39NO |
| Molecular Weight | 333.56 g/mol |
| Exact Mass | 333.30 |
| IUPAC Name | N-[1-(2-hexoxyphenyl)ethyl]octan-1-amine |
| SMILES | CCCCCCCCNC(C)c1ccccc1OCCCCCC |
| InChI | InChI=1S/C22H39NO/c1-4-6-8-10-11-14-18-23-20(3)21-16-12-13-17-22(21)24-19-15-9-7-5-2/h12-13,16-17,20,23H,4-11,14-15,18-19H2,1-3H3 |
| InChIKey | KOAROPIZZANFNJ-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.56 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|