C22H31NO — CID 54804469
N-[1-(2-pentoxyphenyl)ethyl]-3-phenylpropan-1-amine (PubChem CID 54804469) has the molecular formula C22H31NO and a molecular weight of 325.50 g/mol. Its IUPAC name is N-[1-(2-pentoxyphenyl)ethyl]-3-phenylpropan-1-amine.
| Compound Name | N-[1-(2-pentoxyphenyl)ethyl]-3-phenylpropan-1-amine |
|---|---|
| PubChem CID | 54804469 |
| Molecular Formula | C22H31NO |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.24 |
| IUPAC Name | N-[1-(2-pentoxyphenyl)ethyl]-3-phenylpropan-1-amine |
| SMILES | CCCCCOc1ccccc1C(C)NCCCc1ccccc1 |
| InChI | InChI=1S/C22H31NO/c1-3-4-10-18-24-22-16-9-8-15-21(22)19(2)23-17-11-14-20-12-6-5-7-13-20/h5-9,12-13,15-16,19,23H,3-4,10-11,14,17-18H2,1-2H3 |
| InChIKey | FXQZWPNYKSUPOM-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|