C16H21N3O5S — CID 158588270
1-[3-[(2R)-2-phenylpropyl]sulfonylpropoxymethyl]-1,3,5-triazine-2,4-dione (PubChem CID 158588270) has the molecular formula C16H21N3O5S and a molecular weight of 367.43 g/mol. Its IUPAC name is 1-[3-[(2R)-2-phenylpropyl]sulfonylpropoxymethyl]-1,3,5-triazine-2,4-dione.
| Compound Name | 1-[3-[(2R)-2-phenylpropyl]sulfonylpropoxymethyl]-1,3,5-triazine-2,4-dione |
|---|---|
| PubChem CID | 158588270 |
| Molecular Formula | C16H21N3O5S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 1-[3-[(2R)-2-phenylpropyl]sulfonylpropoxymethyl]-1,3,5-triazine-2,4-dione |
| SMILES | C[C@@H](CS(=O)(=O)CCCOCn1cnc(=O)[nH]c1=O)c1ccccc1 |
| InChI | InChI=1S/C16H21N3O5S/c1-13(14-6-3-2-4-7-14)10-25(22,23)9-5-8-24-12-19-11-17-15(20)18-16(19)21/h2-4,6-7,11,13H,5,8-10,12H2,1H3,(H,18,20,21)/t13-/m0/s1 |
| InChIKey | HUCMNFDCRWYYGD-ZDUSSCGKSA-N |
| XLogP | 0.51 |
| TPSA | 111.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|