C10H10N2O2 — CID 15398145
1-(cyclopenta-2,4-dien-1-ylmethyl)pyrimidine-2,4-dione (PubChem CID 15398145) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is 1-(cyclopenta-2,4-dien-1-ylmethyl)pyrimidine-2,4-dione.
| Compound Name | 1-(cyclopenta-2,4-dien-1-ylmethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 15398145 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 1-(cyclopenta-2,4-dien-1-ylmethyl)pyrimidine-2,4-dione |
| SMILES | O=c1ccn(CC2C=CC=C2)c(=O)[nH]1 |
| InChI | InChI=1S/C10H10N2O2/c13-9-5-6-12(10(14)11-9)7-8-3-1-2-4-8/h1-6,8H,7H2,(H,11,13,14) |
| InChIKey | USWBCTSXDZPCRO-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |