C9H13N2NaO9P — CID 66780829
1-(uracil-1-yl)-3-O-(phosphonomethyl)-L-threose sodium salt (PubChem CID 66780829) has the molecular formula C9H13N2NaO9P and a molecular weight of 347.17 g/mol.
| Compound Name | 1-(uracil-1-yl)-3-O-(phosphonomethyl)-L-threose sodium salt |
|---|---|
| PubChem CID | 66780829 |
| Molecular Formula | C9H13N2NaO9P |
| Molecular Weight | 347.17 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | — |
| SMILES | O=C([C@H](O)[C@H](CO)OCP(=O)(O)O)n1ccc(=O)[nH]c1=O.[Na] |
| InChI | InChI=1S/C9H13N2O9P.Na/c12-3-5(20-4-21(17,18)19)7(14)8(15)11-2-1-6(13)10-9(11)16;/h1-2,5,7,12,14H,3-4H2,(H,10,13,16)(H2,17,18,19);/t5-,7+;/m0./s1 |
| InChIKey | CFKKHANTIGQSFK-VOLNJMMDSA-N |
| XLogP | -3.33 |
| TPSA | 179.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.17 |
| LogP ≤ 5 | -3.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|