C13H19FN3O9P — CID 87400870
(2S)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxo(413C)pyrimidin-1-yl)-4-fluoro-3-hydroxy-2-(trideuteriomethyl)oxolan-2-yl]methoxy-hydroxyphosphoryl]amino]propanoic acid (PubChem CID 87400870) has the molecular formula C13H19FN3O9P and a molecular weight of 415.29 g/mol. Its IUPAC name is (2S)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxo(413C)pyrimidin-1-yl)-4-fluoro-3-hydroxy-2-(trideuteriomethyl)oxolan-2-yl]methoxy-hydroxyphosphoryl]amino]propanoic acid.
| Compound Name | (2S)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxo(413C)pyrimidin-1-yl)-4-fluoro-3-hydroxy-2-(trideuteriomethyl)oxolan-2-yl]methoxy-hydroxyphosphoryl]amino]propanoic acid |
|---|---|
| PubChem CID | 87400870 |
| Molecular Formula | C13H19FN3O9P |
| Molecular Weight | 415.29 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | (2S)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxo(413C)pyrimidin-1-yl)-4-fluoro-3-hydroxy-2-(trideuteriomethyl)oxolan-2-yl]methoxy-hydroxyphosphoryl]amino]propanoic acid |
| SMILES | [2H]C([2H])([2H])[C@]1(COP(=O)(O)N[C@@H](C)C(=O)O)O[C@@H](n2cc[13c](=O)[nH]c2=O)[C@H](F)[C@@H]1O |
| InChI | InChI=1S/C13H19FN3O9P/c1-6(11(20)21)16-27(23,24)25-5-13(2)9(19)8(14)10(26-13)17-4-3-7(18)15-12(17)22/h3-4,6,8-10,19H,5H2,1-2H3,(H,20,21)(H,15,18,22)(H2,16,23,24)/t6-,8+,9-,10+,13+/m0/s1/i2D3,7+1 |
| InChIKey | IKRDJBUMEJFHQW-STAPAFBMSA-N |
| XLogP | -1.30 |
| TPSA | 180.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.29 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|