C15H23FN3O10P — CID 172580875
[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-fluoro-3,4-dihydroxyoxolan-2-yl]methoxy-N-[(2S)-1-oxo-1-propoxypropan-2-yl]phosphonamidic acid (PubChem CID 172580875) has the molecular formula C15H23FN3O10P and a molecular weight of 455.33 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-fluoro-3,4-dihydroxyoxolan-2-yl]methoxy-N-[(2S)-1-oxo-1-propoxypropan-2-yl]phosphonamidic acid.
| Compound Name | [(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-fluoro-3,4-dihydroxyoxolan-2-yl]methoxy-N-[(2S)-1-oxo-1-propoxypropan-2-yl]phosphonamidic acid |
|---|---|
| PubChem CID | 172580875 |
| Molecular Formula | C15H23FN3O10P |
| Molecular Weight | 455.33 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | [(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-fluoro-3,4-dihydroxyoxolan-2-yl]methoxy-N-[(2S)-1-oxo-1-propoxypropan-2-yl]phosphonamidic acid |
| SMILES | CCCOC(=O)[C@H](C)NP(=O)(O)OC[C@@]1(F)O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H23FN3O10P/c1-3-6-27-13(23)8(2)18-30(25,26)28-7-15(16)11(22)10(21)12(29-15)19-5-4-9(20)17-14(19)24/h4-5,8,10-12,21-22H,3,6-7H2,1-2H3,(H,17,20,24)(H2,18,25,26)/t8-,10+,11-,12+,15+/m0/s1 |
| InChIKey | JRWMNSDZXQZYKI-ZGWNKZGNSA-N |
| XLogP | -1.50 |
| TPSA | 189.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.33 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|