C15H14N2 — CID 19916805
4-(2-phenylethyl)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 19916805) has the molecular formula C15H14N2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 4-(2-phenylethyl)-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 4-(2-phenylethyl)-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 19916805 |
| Molecular Formula | C15H14N2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 4-(2-phenylethyl)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | c1ccc(CCc2ccnc3[nH]ccc23)cc1 |
| InChI | InChI=1S/C15H14N2/c1-2-4-12(5-3-1)6-7-13-8-10-16-15-14(13)9-11-17-15/h1-5,8-11H,6-7H2,(H,16,17) |
| InChIKey | NLKBCAXKNOVEGZ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |