C27H34N3O8P — CID 177364870
propan-2-yl (2R)-2-[[[(3aS,4S,6R,6aR)-2,2-dimethyl-4-(1H-pyrrolo[2,3-b]pyridin-4-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 177364870) has the molecular formula C27H34N3O8P and a molecular weight of 559.56 g/mol. Its IUPAC name is propan-2-yl (2R)-2-[[[(3aS,4S,6R,6aR)-2,2-dimethyl-4-(1H-pyrrolo[2,3-b]pyridin-4-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2R)-2-[[[(3aS,4S,6R,6aR)-2,2-dimethyl-4-(1H-pyrrolo[2,3-b]pyridin-4-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 177364870 |
| Molecular Formula | C27H34N3O8P |
| Molecular Weight | 559.56 g/mol |
| Exact Mass | 559.21 |
| IUPAC Name | propan-2-yl (2R)-2-[[[(3aS,4S,6R,6aR)-2,2-dimethyl-4-(1H-pyrrolo[2,3-b]pyridin-4-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@@H](C)N[P@@](=O)(OC[C@H]1O[C@@H](c2ccnc3[nH]ccc23)[C@@H]2OC(C)(C)O[C@@H]21)Oc1ccccc1 |
| InChI | InChI=1S/C27H34N3O8P/c1-16(2)34-26(31)17(3)30-39(32,38-18-9-7-6-8-10-18)33-15-21-23-24(37-27(4,5)36-23)22(35-21)19-11-13-28-25-20(19)12-14-29-25/h6-14,16-17,21-24H,15H2,1-5H3,(H,28,29)(H,30,32)/t17-,21-,22+,23-,24+,39-/m1/s1 |
| InChIKey | KMTCOMLTPKEUNI-BQVTXFLUSA-N |
| XLogP | 4.66 |
| TPSA | 130.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.56 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|