C19H21BrNO7P — CID 145200669
methyl 3-bromo-4-[[(2-oxo-2-propan-2-yloxyethyl)amino]-phenoxyphosphoryl]oxybenzoate (PubChem CID 145200669) has the molecular formula C19H21BrNO7P and a molecular weight of 486.26 g/mol. Its IUPAC name is methyl 3-bromo-4-[[(2-oxo-2-propan-2-yloxyethyl)amino]-phenoxyphosphoryl]oxybenzoate.
| Compound Name | methyl 3-bromo-4-[[(2-oxo-2-propan-2-yloxyethyl)amino]-phenoxyphosphoryl]oxybenzoate |
|---|---|
| PubChem CID | 145200669 |
| Molecular Formula | C19H21BrNO7P |
| Molecular Weight | 486.26 g/mol |
| Exact Mass | 485.02 |
| IUPAC Name | methyl 3-bromo-4-[[(2-oxo-2-propan-2-yloxyethyl)amino]-phenoxyphosphoryl]oxybenzoate |
| SMILES | COC(=O)c1ccc(OP(=O)(NCC(=O)OC(C)C)Oc2ccccc2)c(Br)c1 |
| InChI | InChI=1S/C19H21BrNO7P/c1-13(2)26-18(22)12-21-29(24,27-15-7-5-4-6-8-15)28-17-10-9-14(11-16(17)20)19(23)25-3/h4-11,13H,12H2,1-3H3,(H,21,24) |
| InChIKey | GHZGZSUPLCUJMN-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.26 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|