C15H24NO4PS — CID 123715988
propan-2-yl 2-[[phenoxymethyl(propylsulfanyl)phosphoryl]amino]acetate (PubChem CID 123715988) has the molecular formula C15H24NO4PS and a molecular weight of 345.40 g/mol. Its IUPAC name is propan-2-yl 2-[[phenoxymethyl(propylsulfanyl)phosphoryl]amino]acetate.
| Compound Name | propan-2-yl 2-[[phenoxymethyl(propylsulfanyl)phosphoryl]amino]acetate |
|---|---|
| PubChem CID | 123715988 |
| Molecular Formula | C15H24NO4PS |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | propan-2-yl 2-[[phenoxymethyl(propylsulfanyl)phosphoryl]amino]acetate |
| SMILES | CCCSP(=O)(COc1ccccc1)NCC(=O)OC(C)C |
| InChI | InChI=1S/C15H24NO4PS/c1-4-10-22-21(18,16-11-15(17)20-13(2)3)12-19-14-8-6-5-7-9-14/h5-9,13H,4,10-12H2,1-3H3,(H,16,18) |
| InChIKey | WTUGRXZKACLJRX-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|