C17H23NO7S — CID 142436473
methylsulfanylcarbonyloxymethyl acetate;propan-2-yl 2-benzamidoacetate (PubChem CID 142436473) has the molecular formula C17H23NO7S and a molecular weight of 385.44 g/mol. Its IUPAC name is methylsulfanylcarbonyloxymethyl acetate;propan-2-yl 2-benzamidoacetate.
| Compound Name | methylsulfanylcarbonyloxymethyl acetate;propan-2-yl 2-benzamidoacetate |
|---|---|
| PubChem CID | 142436473 |
| Molecular Formula | C17H23NO7S |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | methylsulfanylcarbonyloxymethyl acetate;propan-2-yl 2-benzamidoacetate |
| SMILES | CC(C)OC(=O)CNC(=O)c1ccccc1.CSC(=O)OCOC(C)=O |
| InChI | InChI=1S/C12H15NO3.C5H8O4S/c1-9(2)16-11(14)8-13-12(15)10-6-4-3-5-7-10;1-4(6)8-3-9-5(7)10-2/h3-7,9H,8H2,1-2H3,(H,13,15);3H2,1-2H3 |
| InChIKey | UUZXENMYLXNLSO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|