C11H16NO7P — CID 54030377
[[(2-ethoxy-2-oxoethyl)amino]-hydroxymethyl]-phenylperoxyphosphinic acid (PubChem CID 54030377) has the molecular formula C11H16NO7P and a molecular weight of 305.22 g/mol. Its IUPAC name is [[(2-ethoxy-2-oxoethyl)amino]-hydroxymethyl]-phenylperoxyphosphinic acid.
| Compound Name | [[(2-ethoxy-2-oxoethyl)amino]-hydroxymethyl]-phenylperoxyphosphinic acid |
|---|---|
| PubChem CID | 54030377 |
| Molecular Formula | C11H16NO7P |
| Molecular Weight | 305.22 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | [[(2-ethoxy-2-oxoethyl)amino]-hydroxymethyl]-phenylperoxyphosphinic acid |
| SMILES | CCOC(=O)CNC(O)P(=O)(O)OOc1ccccc1 |
| InChI | InChI=1S/C11H16NO7P/c1-2-17-10(13)8-12-11(14)20(15,16)19-18-9-6-4-3-5-7-9/h3-7,11-12,14H,2,8H2,1H3,(H,15,16) |
| InChIKey | LFDUWTYDLUPYKU-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.22 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|