C13H15F3NO7PS2 — CID 88775931
[disulfanyl-[(2-ethoxy-2-oxoethyl)-(2,2,2-trifluoroacetyl)amino]methyl]-phenylperoxyphosphinic acid (PubChem CID 88775931) has the molecular formula C13H15F3NO7PS2 and a molecular weight of 449.37 g/mol. Its IUPAC name is [disulfanyl-[(2-ethoxy-2-oxoethyl)-(2,2,2-trifluoroacetyl)amino]methyl]-phenylperoxyphosphinic acid.
| Compound Name | [disulfanyl-[(2-ethoxy-2-oxoethyl)-(2,2,2-trifluoroacetyl)amino]methyl]-phenylperoxyphosphinic acid |
|---|---|
| PubChem CID | 88775931 |
| Molecular Formula | C13H15F3NO7PS2 |
| Molecular Weight | 449.37 g/mol |
| Exact Mass | 449.00 |
| IUPAC Name | [disulfanyl-[(2-ethoxy-2-oxoethyl)-(2,2,2-trifluoroacetyl)amino]methyl]-phenylperoxyphosphinic acid |
| SMILES | CCOC(=O)CN(C(=O)C(F)(F)F)C(SS)P(=O)(O)OOc1ccccc1 |
| InChI | InChI=1S/C13H15F3NO7PS2/c1-2-22-10(18)8-17(11(19)13(14,15)16)12(27-26)25(20,21)24-23-9-6-4-3-5-7-9/h3-7,12,26H,2,8H2,1H3,(H,20,21) |
| InChIKey | YGDDHOODTHPSOA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.37 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|