C14H18F3NO2 — CID 64591515
phenyl N-pentan-3-yl-N-(2,2,2-trifluoroethyl)carbamate (PubChem CID 64591515) has the molecular formula C14H18F3NO2 and a molecular weight of 289.30 g/mol. Its IUPAC name is phenyl N-pentan-3-yl-N-(2,2,2-trifluoroethyl)carbamate.
| Compound Name | phenyl N-pentan-3-yl-N-(2,2,2-trifluoroethyl)carbamate |
|---|---|
| PubChem CID | 64591515 |
| Molecular Formula | C14H18F3NO2 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | phenyl N-pentan-3-yl-N-(2,2,2-trifluoroethyl)carbamate |
| SMILES | CCC(CC)N(CC(F)(F)F)C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C14H18F3NO2/c1-3-11(4-2)18(10-14(15,16)17)13(19)20-12-8-6-5-7-9-12/h5-9,11H,3-4,10H2,1-2H3 |
| InChIKey | XFQMQSFMCHSPHQ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |