C10H18F3NO2 — CID 64591828
ethyl N-pentan-3-yl-N-(2,2,2-trifluoroethyl)carbamate (PubChem CID 64591828) has the molecular formula C10H18F3NO2 and a molecular weight of 241.25 g/mol. Its IUPAC name is ethyl N-pentan-3-yl-N-(2,2,2-trifluoroethyl)carbamate.
| Compound Name | ethyl N-pentan-3-yl-N-(2,2,2-trifluoroethyl)carbamate |
|---|---|
| PubChem CID | 64591828 |
| Molecular Formula | C10H18F3NO2 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | ethyl N-pentan-3-yl-N-(2,2,2-trifluoroethyl)carbamate |
| SMILES | CCOC(=O)N(CC(F)(F)F)C(CC)CC |
| InChI | InChI=1S/C10H18F3NO2/c1-4-8(5-2)14(7-10(11,12)13)9(15)16-6-3/h8H,4-7H2,1-3H3 |
| InChIKey | LJPVSXZKOJBQQV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |