C11H16F3NO3 — CID 54875345
(E)-4-oxo-4-[pentan-3-yl(2,2,2-trifluoroethyl)amino]but-2-enoic acid (PubChem CID 54875345) has the molecular formula C11H16F3NO3 and a molecular weight of 267.25 g/mol. Its IUPAC name is (E)-4-oxo-4-[pentan-3-yl(2,2,2-trifluoroethyl)amino]but-2-enoic acid.
| Compound Name | (E)-4-oxo-4-[pentan-3-yl(2,2,2-trifluoroethyl)amino]but-2-enoic acid |
|---|---|
| PubChem CID | 54875345 |
| Molecular Formula | C11H16F3NO3 |
| Molecular Weight | 267.25 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | (E)-4-oxo-4-[pentan-3-yl(2,2,2-trifluoroethyl)amino]but-2-enoic acid |
| SMILES | CCC(CC)N(CC(F)(F)F)C(=O)/C=C/C(=O)O |
| InChI | InChI=1S/C11H16F3NO3/c1-3-8(4-2)15(7-11(12,13)14)9(16)5-6-10(17)18/h5-6,8H,3-4,7H2,1-2H3,(H,17,18)/b6-5+ |
| InChIKey | GDILZNNNXDLCRP-AATRIKPKSA-N |
| XLogP | 2.21 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.25 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|