C23H27Cl3F3NO4 — CID 158725276
1-chloropentane;phenyl carbonochloridate;phenyl N-(2-chloroethyl)-N-(2,2,2-trifluoroethyl)carbamate (PubChem CID 158725276) has the molecular formula C23H27Cl3F3NO4 and a molecular weight of 544.83 g/mol. Its IUPAC name is 1-chloropentane;phenyl carbonochloridate;phenyl N-(2-chloroethyl)-N-(2,2,2-trifluoroethyl)carbamate.
| Compound Name | 1-chloropentane;phenyl carbonochloridate;phenyl N-(2-chloroethyl)-N-(2,2,2-trifluoroethyl)carbamate |
|---|---|
| PubChem CID | 158725276 |
| Molecular Formula | C23H27Cl3F3NO4 |
| Molecular Weight | 544.83 g/mol |
| Exact Mass | 543.10 |
| IUPAC Name | 1-chloropentane;phenyl carbonochloridate;phenyl N-(2-chloroethyl)-N-(2,2,2-trifluoroethyl)carbamate |
| SMILES | CCCCCCl.O=C(Cl)Oc1ccccc1.O=C(Oc1ccccc1)N(CCCl)CC(F)(F)F |
| InChI | InChI=1S/C11H11ClF3NO2.C7H5ClO2.C5H11Cl/c12-6-7-16(8-11(13,14)15)10(17)18-9-4-2-1-3-5-9;8-7(9)10-6-4-2-1-3-5-6;1-2-3-4-5-6/h1-5H,6-8H2;1-5H;2-5H2,1H3 |
| InChIKey | IKKPJDKRVDAOJP-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.83 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|