C14H17ClF3NO2 — CID 107492222
N-(2-chloroethyl)-3-(4-methoxyphenyl)-N-(2,2,2-trifluoroethyl)propanamide (PubChem CID 107492222) has the molecular formula C14H17ClF3NO2 and a molecular weight of 323.74 g/mol. Its IUPAC name is N-(2-chloroethyl)-3-(4-methoxyphenyl)-N-(2,2,2-trifluoroethyl)propanamide.
| Compound Name | N-(2-chloroethyl)-3-(4-methoxyphenyl)-N-(2,2,2-trifluoroethyl)propanamide |
|---|---|
| PubChem CID | 107492222 |
| Molecular Formula | C14H17ClF3NO2 |
| Molecular Weight | 323.74 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | N-(2-chloroethyl)-3-(4-methoxyphenyl)-N-(2,2,2-trifluoroethyl)propanamide |
| SMILES | COc1ccc(CCC(=O)N(CCCl)CC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H17ClF3NO2/c1-21-12-5-2-11(3-6-12)4-7-13(20)19(9-8-15)10-14(16,17)18/h2-3,5-6H,4,7-10H2,1H3 |
| InChIKey | KNPHAXPVXFNGSJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.74 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|