C15H19F3NO7PS — CID 54284133
[[(2-ethoxy-2-oxoethyl)-(2,2,2-trifluoroacetyl)amino]-phenoxymethyl]-ethylsulfanyloxyphosphinic acid (PubChem CID 54284133) has the molecular formula C15H19F3NO7PS and a molecular weight of 445.35 g/mol. Its IUPAC name is [[(2-ethoxy-2-oxoethyl)-(2,2,2-trifluoroacetyl)amino]-phenoxymethyl]-ethylsulfanyloxyphosphinic acid.
| Compound Name | [[(2-ethoxy-2-oxoethyl)-(2,2,2-trifluoroacetyl)amino]-phenoxymethyl]-ethylsulfanyloxyphosphinic acid |
|---|---|
| PubChem CID | 54284133 |
| Molecular Formula | C15H19F3NO7PS |
| Molecular Weight | 445.35 g/mol |
| Exact Mass | 445.06 |
| IUPAC Name | [[(2-ethoxy-2-oxoethyl)-(2,2,2-trifluoroacetyl)amino]-phenoxymethyl]-ethylsulfanyloxyphosphinic acid |
| SMILES | CCOC(=O)CN(C(=O)C(F)(F)F)C(Oc1ccccc1)P(=O)(O)OSCC |
| InChI | InChI=1S/C15H19F3NO7PS/c1-3-24-12(20)10-19(13(21)15(16,17)18)14(27(22,23)26-28-4-2)25-11-8-6-5-7-9-11/h5-9,14H,3-4,10H2,1-2H3,(H,22,23) |
| InChIKey | RSXASIVKSFHOBA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|