C19H19F3NO8P — CID 88760349
2-[[diphenoxy(phosphono)methyl]-(2,2,2-trifluoroacetyl)amino]butanoic acid (PubChem CID 88760349) has the molecular formula C19H19F3NO8P and a molecular weight of 477.33 g/mol. Its IUPAC name is 2-[[diphenoxy(phosphono)methyl]-(2,2,2-trifluoroacetyl)amino]butanoic acid.
| Compound Name | 2-[[diphenoxy(phosphono)methyl]-(2,2,2-trifluoroacetyl)amino]butanoic acid |
|---|---|
| PubChem CID | 88760349 |
| Molecular Formula | C19H19F3NO8P |
| Molecular Weight | 477.33 g/mol |
| Exact Mass | 477.08 |
| IUPAC Name | 2-[[diphenoxy(phosphono)methyl]-(2,2,2-trifluoroacetyl)amino]butanoic acid |
| SMILES | CCC(C(=O)O)N(C(=O)C(F)(F)F)C(Oc1ccccc1)(Oc1ccccc1)P(=O)(O)O |
| InChI | InChI=1S/C19H19F3NO8P/c1-2-15(16(24)25)23(17(26)18(20,21)22)19(32(27,28)29,30-13-9-5-3-6-10-13)31-14-11-7-4-8-12-14/h3-12,15H,2H2,1H3,(H,24,25)(H2,27,28,29) |
| InChIKey | SOMJQGRSUBTYKN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 133.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|