C17H28NO4P — CID 126647671
propan-2-yl (2S)-2-[[tert-butyl-(3-methylphenoxy)phosphoryl]amino]propanoate (PubChem CID 126647671) has the molecular formula C17H28NO4P and a molecular weight of 341.39 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[tert-butyl-(3-methylphenoxy)phosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[tert-butyl-(3-methylphenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 126647671 |
| Molecular Formula | C17H28NO4P |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | propan-2-yl (2S)-2-[[tert-butyl-(3-methylphenoxy)phosphoryl]amino]propanoate |
| SMILES | Cc1cccc(OP(=O)(N[C@@H](C)C(=O)OC(C)C)C(C)(C)C)c1 |
| InChI | InChI=1S/C17H28NO4P/c1-12(2)21-16(19)14(4)18-23(20,17(5,6)7)22-15-10-8-9-13(3)11-15/h8-12,14H,1-7H3,(H,18,20)/t14-,23?/m0/s1 |
| InChIKey | UEWSWJNKBLQTKA-JRQMZCAUSA-N |
| XLogP | 4.30 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|