C18H25N2O5PS — CID 21423552
[1-(dimethylsulfamoylamino)butyl-phenoxyphosphoryl]oxybenzene (PubChem CID 21423552) has the molecular formula C18H25N2O5PS and a molecular weight of 412.45 g/mol. Its IUPAC name is [1-(dimethylsulfamoylamino)butyl-phenoxyphosphoryl]oxybenzene.
| Compound Name | [1-(dimethylsulfamoylamino)butyl-phenoxyphosphoryl]oxybenzene |
|---|---|
| PubChem CID | 21423552 |
| Molecular Formula | C18H25N2O5PS |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | [1-(dimethylsulfamoylamino)butyl-phenoxyphosphoryl]oxybenzene |
| SMILES | CCCC(NS(=O)(=O)N(C)C)P(=O)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C18H25N2O5PS/c1-4-11-18(19-27(22,23)20(2)3)26(21,24-16-12-7-5-8-13-16)25-17-14-9-6-10-15-17/h5-10,12-15,18-19H,4,11H2,1-3H3 |
| InChIKey | SBBNPDUZXRHUPK-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|