C27H30ClO3P — CID 46867859
1-chloro-4-(1-diphenoxyphosphoryl-2-methylideneoctyl)benzene (PubChem CID 46867859) has the molecular formula C27H30ClO3P and a molecular weight of 468.96 g/mol. Its IUPAC name is 1-chloro-4-(1-diphenoxyphosphoryl-2-methylideneoctyl)benzene.
| Compound Name | 1-chloro-4-(1-diphenoxyphosphoryl-2-methylideneoctyl)benzene |
|---|---|
| PubChem CID | 46867859 |
| Molecular Formula | C27H30ClO3P |
| Molecular Weight | 468.96 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | 1-chloro-4-(1-diphenoxyphosphoryl-2-methylideneoctyl)benzene |
| SMILES | C=C(CCCCCC)C(c1ccc(Cl)cc1)P(=O)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C27H30ClO3P/c1-3-4-5-8-13-22(2)27(23-18-20-24(28)21-19-23)32(29,30-25-14-9-6-10-15-25)31-26-16-11-7-12-17-26/h6-7,9-12,14-21,27H,2-5,8,13H2,1H3 |
| InChIKey | NJSCJZSMLXPRQG-UHFFFAOYSA-N |
| XLogP | 9.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.96 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|