C24H20F3O4P — CID 56957634
3-[diphenoxyphosphoryl-[4-(trifluoromethyl)phenyl]methyl]but-3-en-2-one (PubChem CID 56957634) has the molecular formula C24H20F3O4P and a molecular weight of 460.39 g/mol. Its IUPAC name is 3-[diphenoxyphosphoryl-[4-(trifluoromethyl)phenyl]methyl]but-3-en-2-one.
| Compound Name | 3-[diphenoxyphosphoryl-[4-(trifluoromethyl)phenyl]methyl]but-3-en-2-one |
|---|---|
| PubChem CID | 56957634 |
| Molecular Formula | C24H20F3O4P |
| Molecular Weight | 460.39 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | 3-[diphenoxyphosphoryl-[4-(trifluoromethyl)phenyl]methyl]but-3-en-2-one |
| SMILES | C=C(C(C)=O)C(c1ccc(C(F)(F)F)cc1)P(=O)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C24H20F3O4P/c1-17(18(2)28)23(19-13-15-20(16-14-19)24(25,26)27)32(29,30-21-9-5-3-6-10-21)31-22-11-7-4-8-12-22/h3-16,23H,1H2,2H3 |
| InChIKey | UPPPDCNDIHOQIT-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.39 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|