C21H20F3NO5S — CID 54771219
methyl N-[(1S)-2-methylidene-3-oxo-1-[4-(trifluoromethyl)phenyl]butyl]-N-(4-methylphenyl)sulfonylcarbamate (PubChem CID 54771219) has the molecular formula C21H20F3NO5S and a molecular weight of 455.45 g/mol. Its IUPAC name is methyl N-[(1S)-2-methylidene-3-oxo-1-[4-(trifluoromethyl)phenyl]butyl]-N-(4-methylphenyl)sulfonylcarbamate.
| Compound Name | methyl N-[(1S)-2-methylidene-3-oxo-1-[4-(trifluoromethyl)phenyl]butyl]-N-(4-methylphenyl)sulfonylcarbamate |
|---|---|
| PubChem CID | 54771219 |
| Molecular Formula | C21H20F3NO5S |
| Molecular Weight | 455.45 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | methyl N-[(1S)-2-methylidene-3-oxo-1-[4-(trifluoromethyl)phenyl]butyl]-N-(4-methylphenyl)sulfonylcarbamate |
| SMILES | C=C(C(C)=O)[C@H](c1ccc(C(F)(F)F)cc1)N(C(=O)OC)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H20F3NO5S/c1-13-5-11-18(12-6-13)31(28,29)25(20(27)30-4)19(14(2)15(3)26)16-7-9-17(10-8-16)21(22,23)24/h5-12,19H,2H2,1,3-4H3/t19-/m1/s1 |
| InChIKey | YHAQYWOBLFTASR-LJQANCHMSA-N |
| XLogP | 4.66 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.45 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|