C21H22ClNO5S — CID 54771217
ethyl N-[(1S)-1-(4-chlorophenyl)-2-methylidene-3-oxobutyl]-N-(4-methylphenyl)sulfonylcarbamate (PubChem CID 54771217) has the molecular formula C21H22ClNO5S and a molecular weight of 435.93 g/mol. Its IUPAC name is ethyl N-[(1S)-1-(4-chlorophenyl)-2-methylidene-3-oxobutyl]-N-(4-methylphenyl)sulfonylcarbamate.
| Compound Name | ethyl N-[(1S)-1-(4-chlorophenyl)-2-methylidene-3-oxobutyl]-N-(4-methylphenyl)sulfonylcarbamate |
|---|---|
| PubChem CID | 54771217 |
| Molecular Formula | C21H22ClNO5S |
| Molecular Weight | 435.93 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | ethyl N-[(1S)-1-(4-chlorophenyl)-2-methylidene-3-oxobutyl]-N-(4-methylphenyl)sulfonylcarbamate |
| SMILES | C=C(C(C)=O)[C@H](c1ccc(Cl)cc1)N(C(=O)OCC)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H22ClNO5S/c1-5-28-21(25)23(29(26,27)19-12-6-14(2)7-13-19)20(15(3)16(4)24)17-8-10-18(22)11-9-17/h6-13,20H,3,5H2,1-2,4H3/t20-/m1/s1 |
| InChIKey | OMQRZKLELUOVKM-HXUWFJFHSA-N |
| XLogP | 4.68 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.93 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|