C21H24F3NO2SSi — CID 164685083
4-methyl-N-[(1R)-1-[4-(trifluoromethyl)phenyl]-2-trimethylsilylbuta-2,3-dienyl]benzenesulfonamide (PubChem CID 164685083) has the molecular formula C21H24F3NO2SSi and a molecular weight of 439.58 g/mol. Its IUPAC name is 4-methyl-N-[(1R)-1-[4-(trifluoromethyl)phenyl]-2-trimethylsilylbuta-2,3-dienyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(1R)-1-[4-(trifluoromethyl)phenyl]-2-trimethylsilylbuta-2,3-dienyl]benzenesulfonamide |
|---|---|
| PubChem CID | 164685083 |
| Molecular Formula | C21H24F3NO2SSi |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | 4-methyl-N-[(1R)-1-[4-(trifluoromethyl)phenyl]-2-trimethylsilylbuta-2,3-dienyl]benzenesulfonamide |
| SMILES | C=C=C([C@H](NS(=O)(=O)c1ccc(C)cc1)c1ccc(C(F)(F)F)cc1)[Si](C)(C)C |
| InChI | InChI=1S/C21H24F3NO2SSi/c1-6-19(29(3,4)5)20(16-9-11-17(12-10-16)21(22,23)24)25-28(26,27)18-13-7-15(2)8-14-18/h7-14,20,25H,1H2,2-5H3/t20-/m1/s1 |
| InChIKey | GRICNFWOPBVUCL-HXUWFJFHSA-N |
| XLogP | 5.62 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|