C28H30F3NO2S — CID 6636148
N-[(1R)-1-(4-phenylphenyl)-2-propylhex-2-enyl]-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 6636148) has the molecular formula C28H30F3NO2S and a molecular weight of 501.61 g/mol. Its IUPAC name is N-[(1R)-1-(4-phenylphenyl)-2-propylhex-2-enyl]-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[(1R)-1-(4-phenylphenyl)-2-propylhex-2-enyl]-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 6636148 |
| Molecular Formula | C28H30F3NO2S |
| Molecular Weight | 501.61 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | N-[(1R)-1-(4-phenylphenyl)-2-propylhex-2-enyl]-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | CCCC=C(CCC)[C@@H](NS(=O)(=O)c1ccc(C(F)(F)F)cc1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C28H30F3NO2S/c1-3-5-10-23(9-4-2)27(24-15-13-22(14-16-24)21-11-7-6-8-12-21)32-35(33,34)26-19-17-25(18-20-26)28(29,30)31/h6-8,10-20,27,32H,3-5,9H2,1-2H3/t27-/m1/s1 |
| InChIKey | QWJMXURFUSFTNV-HHHXNRCGSA-N |
| XLogP | 7.92 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.61 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|