C24H25F6NO — CID 44592653
N-[(E,1R)-2-propyl-1-[4-(trifluoromethyl)phenyl]hex-2-enyl]-4-(trifluoromethyl)benzamide (PubChem CID 44592653) has the molecular formula C24H25F6NO and a molecular weight of 457.46 g/mol. Its IUPAC name is N-[(E,1R)-2-propyl-1-[4-(trifluoromethyl)phenyl]hex-2-enyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[(E,1R)-2-propyl-1-[4-(trifluoromethyl)phenyl]hex-2-enyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 44592653 |
| Molecular Formula | C24H25F6NO |
| Molecular Weight | 457.46 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | N-[(E,1R)-2-propyl-1-[4-(trifluoromethyl)phenyl]hex-2-enyl]-4-(trifluoromethyl)benzamide |
| SMILES | CCC/C=C(\CCC)[C@@H](NC(=O)c1ccc(C(F)(F)F)cc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H25F6NO/c1-3-5-7-16(6-4-2)21(17-8-12-19(13-9-17)23(25,26)27)31-22(32)18-10-14-20(15-11-18)24(28,29)30/h7-15,21H,3-6H2,1-2H3,(H,31,32)/b16-7+/t21-/m1/s1 |
| InChIKey | MHZBDCGUTGSZCH-QLKYELJLSA-N |
| XLogP | 7.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.46 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|