C24H28F3NO4S — CID 6636135
methyl 4-[(1R)-2-propyl-1-[[3-(trifluoromethyl)phenyl]sulfonylamino]hex-2-enyl]benzoate (PubChem CID 6636135) has the molecular formula C24H28F3NO4S and a molecular weight of 483.55 g/mol. Its IUPAC name is methyl 4-[(1R)-2-propyl-1-[[3-(trifluoromethyl)phenyl]sulfonylamino]hex-2-enyl]benzoate.
| Compound Name | methyl 4-[(1R)-2-propyl-1-[[3-(trifluoromethyl)phenyl]sulfonylamino]hex-2-enyl]benzoate |
|---|---|
| PubChem CID | 6636135 |
| Molecular Formula | C24H28F3NO4S |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | methyl 4-[(1R)-2-propyl-1-[[3-(trifluoromethyl)phenyl]sulfonylamino]hex-2-enyl]benzoate |
| SMILES | CCCC=C(CCC)[C@@H](NS(=O)(=O)c1cccc(C(F)(F)F)c1)c1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C24H28F3NO4S/c1-4-6-9-17(8-5-2)22(18-12-14-19(15-13-18)23(29)32-3)28-33(30,31)21-11-7-10-20(16-21)24(25,26)27/h7,9-16,22,28H,4-6,8H2,1-3H3/t22-/m1/s1 |
| InChIKey | JUXSNGDRQUFCCD-JOCHJYFZSA-N |
| XLogP | 6.04 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|