C16H25F2NO3SSi — CID 11494595
N-(2,2-difluoro-4-methyl-1-oxo-1-trimethylsilylpentan-3-yl)-4-methylbenzenesulfonamide (PubChem CID 11494595) has the molecular formula C16H25F2NO3SSi and a molecular weight of 377.53 g/mol. Its IUPAC name is N-(2,2-difluoro-4-methyl-1-oxo-1-trimethylsilylpentan-3-yl)-4-methylbenzenesulfonamide.
| Compound Name | N-(2,2-difluoro-4-methyl-1-oxo-1-trimethylsilylpentan-3-yl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 11494595 |
| Molecular Formula | C16H25F2NO3SSi |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | N-(2,2-difluoro-4-methyl-1-oxo-1-trimethylsilylpentan-3-yl)-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(C(C)C)C(F)(F)C(=O)[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C16H25F2NO3SSi/c1-11(2)14(16(17,18)15(20)24(4,5)6)19-23(21,22)13-9-7-12(3)8-10-13/h7-11,14,19H,1-6H3 |
| InChIKey | YMVDJEJKKRJMMW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|