C16H15F3N2O3S — CID 163543244
2-[N-(4-methylphenyl)sulfonyl-4-(trifluoromethyl)anilino]acetamide (PubChem CID 163543244) has the molecular formula C16H15F3N2O3S and a molecular weight of 372.37 g/mol. Its IUPAC name is 2-[N-(4-methylphenyl)sulfonyl-4-(trifluoromethyl)anilino]acetamide.
| Compound Name | 2-[N-(4-methylphenyl)sulfonyl-4-(trifluoromethyl)anilino]acetamide |
|---|---|
| PubChem CID | 163543244 |
| Molecular Formula | C16H15F3N2O3S |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 2-[N-(4-methylphenyl)sulfonyl-4-(trifluoromethyl)anilino]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(N)=O)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C16H15F3N2O3S/c1-11-2-8-14(9-3-11)25(23,24)21(10-15(20)22)13-6-4-12(5-7-13)16(17,18)19/h2-9H,10H2,1H3,(H2,20,22) |
| InChIKey | FCWXARCAJGSFJX-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |