C28H33O4P — CID 46867860
1-(1-diphenoxyphosphoryl-2-methylideneoctyl)-3-methoxybenzene (PubChem CID 46867860) has the molecular formula C28H33O4P and a molecular weight of 464.54 g/mol. Its IUPAC name is 1-(1-diphenoxyphosphoryl-2-methylideneoctyl)-3-methoxybenzene.
| Compound Name | 1-(1-diphenoxyphosphoryl-2-methylideneoctyl)-3-methoxybenzene |
|---|---|
| PubChem CID | 46867860 |
| Molecular Formula | C28H33O4P |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 1-(1-diphenoxyphosphoryl-2-methylideneoctyl)-3-methoxybenzene |
| SMILES | C=C(CCCCCC)C(c1cccc(OC)c1)P(=O)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C28H33O4P/c1-4-5-6-9-15-23(2)28(24-16-14-21-27(22-24)30-3)33(29,31-25-17-10-7-11-18-25)32-26-19-12-8-13-20-26/h7-8,10-14,16-22,28H,2,4-6,9,15H2,1,3H3 |
| InChIKey | LYFSGJHOEOLYFK-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|