C22H23ClNOP — CID 102575612
1-(4-chlorophenyl)-N-diphenylphosphorylbutan-1-amine (PubChem CID 102575612) has the molecular formula C22H23ClNOP and a molecular weight of 383.86 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-diphenylphosphorylbutan-1-amine.
| Compound Name | 1-(4-chlorophenyl)-N-diphenylphosphorylbutan-1-amine |
|---|---|
| PubChem CID | 102575612 |
| Molecular Formula | C22H23ClNOP |
| Molecular Weight | 383.86 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 1-(4-chlorophenyl)-N-diphenylphosphorylbutan-1-amine |
| SMILES | CCCC(NP(=O)(c1ccccc1)c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H23ClNOP/c1-2-9-22(18-14-16-19(23)17-15-18)24-26(25,20-10-5-3-6-11-20)21-12-7-4-8-13-21/h3-8,10-17,22H,2,9H2,1H3,(H,24,25) |
| InChIKey | DFKGULAAQIQUEX-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.86 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|