C16H16Cl3N — CID 65467204
2,6-dichloro-N-[1-(4-chlorophenyl)butyl]aniline (PubChem CID 65467204) has the molecular formula C16H16Cl3N and a molecular weight of 328.67 g/mol. Its IUPAC name is 2,6-dichloro-N-[1-(4-chlorophenyl)butyl]aniline.
| Compound Name | 2,6-dichloro-N-[1-(4-chlorophenyl)butyl]aniline |
|---|---|
| PubChem CID | 65467204 |
| Molecular Formula | C16H16Cl3N |
| Molecular Weight | 328.67 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | 2,6-dichloro-N-[1-(4-chlorophenyl)butyl]aniline |
| SMILES | CCCC(Nc1c(Cl)cccc1Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H16Cl3N/c1-2-4-15(11-7-9-12(17)10-8-11)20-16-13(18)5-3-6-14(16)19/h3,5-10,15,20H,2,4H2,1H3 |
| InChIKey | VNSAMYQZPDTRSS-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.67 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |