C22H22NO3P — CID 10948881
(1S)-1-(1,3-benzodioxol-5-yl)-N-diphenylphosphorylpropan-1-amine (PubChem CID 10948881) has the molecular formula C22H22NO3P and a molecular weight of 379.40 g/mol. Its IUPAC name is (1S)-1-(1,3-benzodioxol-5-yl)-N-diphenylphosphorylpropan-1-amine.
| Compound Name | (1S)-1-(1,3-benzodioxol-5-yl)-N-diphenylphosphorylpropan-1-amine |
|---|---|
| PubChem CID | 10948881 |
| Molecular Formula | C22H22NO3P |
| Molecular Weight | 379.40 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | (1S)-1-(1,3-benzodioxol-5-yl)-N-diphenylphosphorylpropan-1-amine |
| SMILES | CC[C@H](NP(=O)(c1ccccc1)c1ccccc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H22NO3P/c1-2-20(17-13-14-21-22(15-17)26-16-25-21)23-27(24,18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-15,20H,2,16H2,1H3,(H,23,24)/t20-/m0/s1 |
| InChIKey | GBTGSYGWEHXTBF-FQEVSTJZSA-N |
| XLogP | 4.39 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.40 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|