C15H24N2O3 — CID 100974742
(2R)-2-[[[(1R)-1-(1,3-benzodioxol-5-yl)propyl]amino]-methylamino]butan-1-ol (PubChem CID 100974742) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is (2R)-2-[[[(1R)-1-(1,3-benzodioxol-5-yl)propyl]amino]-methylamino]butan-1-ol.
| Compound Name | (2R)-2-[[[(1R)-1-(1,3-benzodioxol-5-yl)propyl]amino]-methylamino]butan-1-ol |
|---|---|
| PubChem CID | 100974742 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | (2R)-2-[[[(1R)-1-(1,3-benzodioxol-5-yl)propyl]amino]-methylamino]butan-1-ol |
| SMILES | CC[C@H](CO)N(C)N[C@H](CC)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H24N2O3/c1-4-12(9-18)17(3)16-13(5-2)11-6-7-14-15(8-11)20-10-19-14/h6-8,12-13,16,18H,4-5,9-10H2,1-3H3/t12-,13-/m1/s1 |
| InChIKey | NXYPZEGPEBIJMU-CHWSQXEVSA-N |
| XLogP | 2.07 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|