C17H30N2O4 — CID 100974736
(2R)-2-[methyl-[[(1R)-1-(3,4,5-trimethoxyphenyl)propyl]amino]amino]butan-1-ol (PubChem CID 100974736) has the molecular formula C17H30N2O4 and a molecular weight of 326.44 g/mol. Its IUPAC name is (2R)-2-[methyl-[[(1R)-1-(3,4,5-trimethoxyphenyl)propyl]amino]amino]butan-1-ol.
| Compound Name | (2R)-2-[methyl-[[(1R)-1-(3,4,5-trimethoxyphenyl)propyl]amino]amino]butan-1-ol |
|---|---|
| PubChem CID | 100974736 |
| Molecular Formula | C17H30N2O4 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | (2R)-2-[methyl-[[(1R)-1-(3,4,5-trimethoxyphenyl)propyl]amino]amino]butan-1-ol |
| SMILES | CC[C@H](CO)N(C)N[C@H](CC)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C17H30N2O4/c1-7-13(11-20)19(3)18-14(8-2)12-9-15(21-4)17(23-6)16(10-12)22-5/h9-10,13-14,18,20H,7-8,11H2,1-6H3/t13-,14-/m1/s1 |
| InChIKey | VEJNQLADKVBDPJ-ZIAGYGMSSA-N |
| XLogP | 2.37 |
| TPSA | 63.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|