C13H22N2O3 — CID 116909317
N,N',N'-trimethyl-1-(3,4,5-trimethoxyphenyl)methanediamine (PubChem CID 116909317) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is N,N',N'-trimethyl-1-(3,4,5-trimethoxyphenyl)methanediamine.
| Compound Name | N,N',N'-trimethyl-1-(3,4,5-trimethoxyphenyl)methanediamine |
|---|---|
| PubChem CID | 116909317 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | N,N',N'-trimethyl-1-(3,4,5-trimethoxyphenyl)methanediamine |
| SMILES | CNC(c1cc(OC)c(OC)c(OC)c1)N(C)C |
| InChI | InChI=1S/C13H22N2O3/c1-14-13(15(2)3)9-7-10(16-4)12(18-6)11(8-9)17-5/h7-8,13-14H,1-6H3 |
| InChIKey | AFFGBMDGMVXBIF-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|