C12H20N2O — CID 116909202
1-(2-methoxy-5-methylphenyl)-N,N',N'-trimethylmethanediamine (PubChem CID 116909202) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is 1-(2-methoxy-5-methylphenyl)-N,N',N'-trimethylmethanediamine.
| Compound Name | 1-(2-methoxy-5-methylphenyl)-N,N',N'-trimethylmethanediamine |
|---|---|
| PubChem CID | 116909202 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 1-(2-methoxy-5-methylphenyl)-N,N',N'-trimethylmethanediamine |
| SMILES | CNC(c1cc(C)ccc1OC)N(C)C |
| InChI | InChI=1S/C12H20N2O/c1-9-6-7-11(15-5)10(8-9)12(13-2)14(3)4/h6-8,12-13H,1-5H3 |
| InChIKey | QBKFWSZVTWJHQJ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|