C11H17BrN2O — CID 116909226
1-(5-bromo-2-methoxyphenyl)-N,N',N'-trimethylmethanediamine (PubChem CID 116909226) has the molecular formula C11H17BrN2O and a molecular weight of 273.17 g/mol. Its IUPAC name is 1-(5-bromo-2-methoxyphenyl)-N,N',N'-trimethylmethanediamine.
| Compound Name | 1-(5-bromo-2-methoxyphenyl)-N,N',N'-trimethylmethanediamine |
|---|---|
| PubChem CID | 116909226 |
| Molecular Formula | C11H17BrN2O |
| Molecular Weight | 273.17 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 1-(5-bromo-2-methoxyphenyl)-N,N',N'-trimethylmethanediamine |
| SMILES | CNC(c1cc(Br)ccc1OC)N(C)C |
| InChI | InChI=1S/C11H17BrN2O/c1-13-11(14(2)3)9-7-8(12)5-6-10(9)15-4/h5-7,11,13H,1-4H3 |
| InChIKey | JTDHXBQKPDELGY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.17 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|