C10H12ClNO2 — CID 116952586
1-(1,3-benzodioxol-5-yl)-2-chloro-N-methylethanamine (PubChem CID 116952586) has the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-2-chloro-N-methylethanamine.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-2-chloro-N-methylethanamine |
|---|---|
| PubChem CID | 116952586 |
| Molecular Formula | C10H12ClNO2 |
| Molecular Weight | 213.66 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-2-chloro-N-methylethanamine |
| SMILES | CNC(CCl)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C10H12ClNO2/c1-12-8(5-11)7-2-3-9-10(4-7)14-6-13-9/h2-4,8,12H,5-6H2,1H3 |
| InChIKey | YWXSIIQQUZIVRY-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.66 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|