C14H13O3P — CID 132523246
5-[methyl(phenyl)phosphoryl]-1,3-benzodioxole (PubChem CID 132523246) has the molecular formula C14H13O3P and a molecular weight of 260.23 g/mol. Its IUPAC name is 5-[methyl(phenyl)phosphoryl]-1,3-benzodioxole.
| Compound Name | 5-[methyl(phenyl)phosphoryl]-1,3-benzodioxole |
|---|---|
| PubChem CID | 132523246 |
| Molecular Formula | C14H13O3P |
| Molecular Weight | 260.23 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 5-[methyl(phenyl)phosphoryl]-1,3-benzodioxole |
| SMILES | CP(=O)(c1ccccc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H13O3P/c1-18(15,11-5-3-2-4-6-11)12-7-8-13-14(9-12)17-10-16-13/h2-9H,10H2,1H3 |
| InChIKey | HSBYXZPGDNJRHV-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.23 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|