C20H19O5P — CID 159667093
1,1'-biphenyl;2,3-dihydro-1,4-benzodioxin-6-ylphosphonic acid (PubChem CID 159667093) has the molecular formula C20H19O5P and a molecular weight of 370.34 g/mol. Its IUPAC name is 1,1'-biphenyl;2,3-dihydro-1,4-benzodioxin-6-ylphosphonic acid.
| Compound Name | 1,1'-biphenyl;2,3-dihydro-1,4-benzodioxin-6-ylphosphonic acid |
|---|---|
| PubChem CID | 159667093 |
| Molecular Formula | C20H19O5P |
| Molecular Weight | 370.34 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 1,1'-biphenyl;2,3-dihydro-1,4-benzodioxin-6-ylphosphonic acid |
| SMILES | O=P(O)(O)c1ccc2c(c1)OCCO2.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C8H9O5P/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;9-14(10,11)6-1-2-7-8(5-6)13-4-3-12-7/h1-10H;1-2,5H,3-4H2,(H2,9,10,11) |
| InChIKey | MTNVLVDCZBZLGL-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.34 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|